C31H18N6S — CID 138639339
20-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-thia-6,8,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene (PubChem CID 138639339) has the molecular formula C31H18N6S and a molecular weight of 506.59 g/mol. Its IUPAC name is 20-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-thia-6,8,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene.
| Compound Name | 20-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-thia-6,8,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 138639339 |
| Molecular Formula | C31H18N6S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 20-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-thia-6,8,20-triazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4ccc5c6ncncc6sc5c43)n2)cc1 |
| InChI | InChI=1S/C31H18N6S/c1-3-9-19(10-4-1)29-34-30(20-11-5-2-6-12-20)36-31(35-29)37-24-14-8-7-13-21(24)22-15-16-23-26-25(17-32-18-33-26)38-28(23)27(22)37/h1-18H |
| InChIKey | LALHRTCCCKGAJE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |