C17H16ClN3O3 — CID 138641934
2-[6-(4-chlorophenyl)-2-oxo-1-pyrimidin-2-ylpiperidin-3-yl]acetic acid (PubChem CID 138641934) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)-2-oxo-1-pyrimidin-2-ylpiperidin-3-yl]acetic acid.
| Compound Name | 2-[6-(4-chlorophenyl)-2-oxo-1-pyrimidin-2-ylpiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 138641934 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[6-(4-chlorophenyl)-2-oxo-1-pyrimidin-2-ylpiperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCC(c2ccc(Cl)cc2)N(c2ncccn2)C1=O |
| InChI | InChI=1S/C17H16ClN3O3/c18-13-5-2-11(3-6-13)14-7-4-12(10-15(22)23)16(24)21(14)17-19-8-1-9-20-17/h1-3,5-6,8-9,12,14H,4,7,10H2,(H,22,23) |
| InChIKey | KDNZDLFPKGUSOE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |