C28H27F3N6O4S — CID 138644275
[[[3-[[4-(3,5-dimethylpiperazin-1-yl)benzoyl]amino]-1H-indazole-5-carbonyl]amino]-thiophen-2-ylmethyl] 2,2,2-trifluoroacetate (PubChem CID 138644275) has the molecular formula C28H27F3N6O4S and a molecular weight of 600.62 g/mol. Its IUPAC name is [[[3-[[4-(3,5-dimethylpiperazin-1-yl)benzoyl]amino]-1H-indazole-5-carbonyl]amino]-thiophen-2-ylmethyl] 2,2,2-trifluoroacetate.
| Compound Name | [[[3-[[4-(3,5-dimethylpiperazin-1-yl)benzoyl]amino]-1H-indazole-5-carbonyl]amino]-thiophen-2-ylmethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 138644275 |
| Molecular Formula | C28H27F3N6O4S |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | [[[3-[[4-(3,5-dimethylpiperazin-1-yl)benzoyl]amino]-1H-indazole-5-carbonyl]amino]-thiophen-2-ylmethyl] 2,2,2-trifluoroacetate |
| SMILES | CC1CN(c2ccc(C(=O)Nc3n[nH]c4ccc(C(=O)NC(OC(=O)C(F)(F)F)c5cccs5)cc34)cc2)CC(C)N1 |
| InChI | InChI=1S/C28H27F3N6O4S/c1-15-13-37(14-16(2)32-15)19-8-5-17(6-9-19)24(38)33-23-20-12-18(7-10-21(20)35-36-23)25(39)34-26(22-4-3-11-42-22)41-27(40)28(29,30)31/h3-12,15-16,26,32H,13-14H2,1-2H3,(H,34,39)(H2,33,35,36,38) |
| InChIKey | NXBJXCAQTRGLRE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|