C31H30FN5O2S2 — CID 138645153
5-(11-fluoro-5,6,8,9-tetrahydroindolo[1,2-h][1,7]naphthyridin-2-yl)-N-methyl-2-(2-methyl-4,5-dihydro-1,3-thiazol-5-yl)-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide (PubChem CID 138645153) has the molecular formula C31H30FN5O2S2 and a molecular weight of 587.75 g/mol. Its IUPAC name is 5-(11-fluoro-5,6,8,9-tetrahydroindolo[1,2-h][1,7]naphthyridin-2-yl)-N-methyl-2-(2-methyl-4,5-dihydro-1,3-thiazol-5-yl)-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide.
| Compound Name | 5-(11-fluoro-5,6,8,9-tetrahydroindolo[1,2-h][1,7]naphthyridin-2-yl)-N-methyl-2-(2-methyl-4,5-dihydro-1,3-thiazol-5-yl)-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 138645153 |
| Molecular Formula | C31H30FN5O2S2 |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | 5-(11-fluoro-5,6,8,9-tetrahydroindolo[1,2-h][1,7]naphthyridin-2-yl)-N-methyl-2-(2-methyl-4,5-dihydro-1,3-thiazol-5-yl)-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(C2CN=C(C)S2)oc2cc(N(C)SC)c(-c3ccc4c(n3)-c3cc5c(n3CC4)CCC=C5F)cc12 |
| InChI | InChI=1S/C31H30FN5O2S2/c1-16-34-15-27(41-16)30-28(31(38)33-2)20-12-19(24(36(3)40-4)14-26(20)39-30)22-9-8-17-10-11-37-23-7-5-6-21(32)18(23)13-25(37)29(17)35-22/h6,8-9,12-14,27H,5,7,10-11,15H2,1-4H3,(H,33,38) |
| InChIKey | UXKUDRVNNPGSBL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|