C33H28FN5O3S — CID 144681513
2-(4-fluorophenyl)-5-(14-methoxy-3,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide (PubChem CID 144681513) has the molecular formula C33H28FN5O3S and a molecular weight of 593.68 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(14-methoxy-3,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-(14-methoxy-3,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 144681513 |
| Molecular Formula | C33H28FN5O3S |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(14-methoxy-3,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)SC)c(-c3ccc4c(n3)-c3cc5nc(OC)ccc5n3CC4)cc12 |
| InChI | InChI=1S/C33H28FN5O3S/c1-35-33(40)30-22-15-21(26(38(2)43-4)17-28(22)42-32(30)19-5-8-20(34)9-6-19)23-10-7-18-13-14-39-25-11-12-29(41-3)36-24(25)16-27(39)31(18)37-23/h5-12,15-17H,13-14H2,1-4H3,(H,35,40) |
| InChIKey | SVIIOWOGOXVOBI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|