C30H25F2N5O2S — CID 134405375
5-[1-(4-fluorobenzenecarboximidoyl)-6-imino-3-pyridinyl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide (PubChem CID 134405375) has the molecular formula C30H25F2N5O2S and a molecular weight of 557.63 g/mol. Its IUPAC name is 5-[1-(4-fluorobenzenecarboximidoyl)-6-imino-3-pyridinyl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide.
| Compound Name | 5-[1-(4-fluorobenzenecarboximidoyl)-6-imino-3-pyridinyl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 134405375 |
| Molecular Formula | C30H25F2N5O2S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 5-[1-(4-fluorobenzenecarboximidoyl)-6-imino-3-pyridinyl]-2-(4-fluorophenyl)-N-methyl-6-[methyl(methylsulfanyl)amino]-1-benzofuran-3-carboxamide |
| SMILES | [H]/N=C(\c1ccc(F)cc1)n1cc(-c2cc3c(C(=O)NC)c(-c4ccc(F)cc4)oc3cc2N(C)SC)cc/c1=N\[H] |
| InChI | InChI=1S/C30H25F2N5O2S/c1-35-30(38)27-23-14-22(19-8-13-26(33)37(16-19)29(34)18-6-11-21(32)12-7-18)24(36(2)40-3)15-25(23)39-28(27)17-4-9-20(31)10-5-17/h4-16,33-34H,1-3H3,(H,35,38)/b33-26+,34-29+ |
| InChIKey | YAUJMXLHDRKGKX-RZUANFEVSA-N |
| XLogP | 6.27 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|