C27H25FN4O3 — CID 144766237
6-(dimethylamino)-2-(4-fluorophenyl)-5-[4-(formamidomethylideneamino)-3-methylphenyl]-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 144766237) has the molecular formula C27H25FN4O3 and a molecular weight of 472.52 g/mol. Its IUPAC name is 6-(dimethylamino)-2-(4-fluorophenyl)-5-[4-(formamidomethylideneamino)-3-methylphenyl]-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-(dimethylamino)-2-(4-fluorophenyl)-5-[4-(formamidomethylideneamino)-3-methylphenyl]-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 144766237 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 6-(dimethylamino)-2-(4-fluorophenyl)-5-[4-(formamidomethylideneamino)-3-methylphenyl]-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)C)c(-c3ccc(/N=C/NC=O)c(C)c3)cc12 |
| InChI | InChI=1S/C27H25FN4O3/c1-16-11-18(7-10-22(16)31-14-30-15-33)20-12-21-24(13-23(20)32(3)4)35-26(25(21)27(34)29-2)17-5-8-19(28)9-6-17/h5-15H,1-4H3,(H,29,34)(H,30,31,33) |
| InChIKey | XZZGDVBJZFYJJP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|