C29H53F2N9O2 — CID 138645679
2-amino-5-cyclohexyl-N-[4-[4-[3-(dimethylamino)propylcarbamoyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-6-fluoro-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 138645679) has the molecular formula C29H53F2N9O2 and a molecular weight of 597.80 g/mol. Its IUPAC name is 2-amino-5-cyclohexyl-N-[4-[4-[3-(dimethylamino)propylcarbamoyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-6-fluoro-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-5-cyclohexyl-N-[4-[4-[3-(dimethylamino)propylcarbamoyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-6-fluoro-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 138645679 |
| Molecular Formula | C29H53F2N9O2 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.43 |
| IUPAC Name | 2-amino-5-cyclohexyl-N-[4-[4-[3-(dimethylamino)propylcarbamoyl]piperidin-1-yl]-5-fluoropiperidin-3-yl]-6-fluoro-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)C1CCN(C2C(F)CNCC2NC(=O)C2C(N)NN3CC(F)C(C4CCCCC4)NC23)CC1 |
| InChI | InChI=1S/C29H53F2N9O2/c1-38(2)12-6-11-34-28(41)19-9-13-39(14-10-19)25-20(30)15-33-16-22(25)35-29(42)23-26(32)37-40-17-21(31)24(36-27(23)40)18-7-4-3-5-8-18/h18-27,33,36-37H,3-17,32H2,1-2H3,(H,34,41)(H,35,42) |
| InChIKey | JWOVJIPOXIZMKJ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|