C16H21ClFNO — CID 138646850
3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclopropylmethyl)-4-methylpyrrolidine-2-carbaldehyde (PubChem CID 138646850) has the molecular formula C16H21ClFNO and a molecular weight of 297.80 g/mol. Its IUPAC name is 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclopropylmethyl)-4-methylpyrrolidine-2-carbaldehyde.
| Compound Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclopropylmethyl)-4-methylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 138646850 |
| Molecular Formula | C16H21ClFNO |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclopropylmethyl)-4-methylpyrrolidine-2-carbaldehyde |
| SMILES | C=C(Cl)/C=C\C=C(/F)C1C(C)CN(CC2CC2)C1C=O |
| InChI | InChI=1S/C16H21ClFNO/c1-11-8-19(9-13-6-7-13)15(10-20)16(11)14(18)5-3-4-12(2)17/h3-5,10-11,13,15-16H,2,6-9H2,1H3/b4-3-,14-5- |
| InChIKey | VKCRQGWLELMPHA-KHCPYNEOSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|