C15H20ClF2NO — CID 138646845
1-butyl-3-[(1Z,3E)-5-chloro-1,4-difluorohexa-1,3,5-trienyl]pyrrolidine-2-carbaldehyde (PubChem CID 138646845) has the molecular formula C15H20ClF2NO and a molecular weight of 303.78 g/mol. Its IUPAC name is 1-butyl-3-[(1Z,3E)-5-chloro-1,4-difluorohexa-1,3,5-trienyl]pyrrolidine-2-carbaldehyde.
| Compound Name | 1-butyl-3-[(1Z,3E)-5-chloro-1,4-difluorohexa-1,3,5-trienyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 138646845 |
| Molecular Formula | C15H20ClF2NO |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-butyl-3-[(1Z,3E)-5-chloro-1,4-difluorohexa-1,3,5-trienyl]pyrrolidine-2-carbaldehyde |
| SMILES | C=C(Cl)/C(F)=C\C=C(/F)C1CCN(CCCC)C1C=O |
| InChI | InChI=1S/C15H20ClF2NO/c1-3-4-8-19-9-7-12(15(19)10-20)14(18)6-5-13(17)11(2)16/h5-6,10,12,15H,2-4,7-9H2,1H3/b13-5+,14-6- |
| InChIKey | IURSFHRTRZXVFE-LSMSNJBFSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|