C12H17NO — CID 142045459
3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde (PubChem CID 142045459) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 142045459 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde |
| SMILES | CN1CCC(C2=CCCC=C2)C1C=O |
| InChI | InChI=1S/C12H17NO/c1-13-8-7-11(12(13)9-14)10-5-3-2-4-6-10/h3,5-6,9,11-12H,2,4,7-8H2,1H3 |
| InChIKey | ADIDRHRABQYUGP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|