C15H25NO2 — CID 143971276
1-[(2S)-1-methylpyrrolidin-2-yl]ethanone;(4Z,6Z)-octa-4,6-dienal (PubChem CID 143971276) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-[(2S)-1-methylpyrrolidin-2-yl]ethanone;(4Z,6Z)-octa-4,6-dienal.
| Compound Name | 1-[(2S)-1-methylpyrrolidin-2-yl]ethanone;(4Z,6Z)-octa-4,6-dienal |
|---|---|
| PubChem CID | 143971276 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-[(2S)-1-methylpyrrolidin-2-yl]ethanone;(4Z,6Z)-octa-4,6-dienal |
| SMILES | C/C=C\C=C/CCC=O.CC(=O)[C@@H]1CCCN1C |
| InChI | InChI=1S/C8H12O.C7H13NO/c1-2-3-4-5-6-7-8-9;1-6(9)7-4-3-5-8(7)2/h2-5,8H,6-7H2,1H3;7H,3-5H2,1-2H3/b3-2-,5-4-;/t;7-/m.0/s1 |
| InChIKey | IQUXPPPEZVPCLJ-VXAKVOHUSA-N |
| XLogP | 2.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|