C12H19NO2 — CID 142045458
3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde;hydrate (PubChem CID 142045458) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde;hydrate.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde;hydrate |
|---|---|
| PubChem CID | 142045458 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-1-methylpyrrolidine-2-carbaldehyde;hydrate |
| SMILES | CN1CCC(C2=CCCC=C2)C1C=O.O |
| InChI | InChI=1S/C12H17NO.H2O/c1-13-8-7-11(12(13)9-14)10-5-3-2-4-6-10;/h3,5-6,9,11-12H,2,4,7-8H2,1H3;1H2 |
| InChIKey | OVFQPUOUGVLGTA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|