C15H25NO — CID 141127521
3-[1-[(2S,3E,5Z)-3-methylhepta-3,5-dien-2-yl]pyrrolidin-3-yl]propanal (PubChem CID 141127521) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-[1-[(2S,3E,5Z)-3-methylhepta-3,5-dien-2-yl]pyrrolidin-3-yl]propanal.
| Compound Name | 3-[1-[(2S,3E,5Z)-3-methylhepta-3,5-dien-2-yl]pyrrolidin-3-yl]propanal |
|---|---|
| PubChem CID | 141127521 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3-[1-[(2S,3E,5Z)-3-methylhepta-3,5-dien-2-yl]pyrrolidin-3-yl]propanal |
| SMILES | C/C=C\C=C(/C)[C@H](C)N1CCC(CCC=O)C1 |
| InChI | InChI=1S/C15H25NO/c1-4-5-7-13(2)14(3)16-10-9-15(12-16)8-6-11-17/h4-5,7,11,14-15H,6,8-10,12H2,1-3H3/b5-4-,13-7+/t14-,15?/m0/s1 |
| InChIKey | RKZXBHDCIGIJCA-ANZURRLUSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|