C22H39NO — CID 144956501
(5E)-4-[[bis(2-methylbutan-2-yl)amino]methyl]-5-[(Z)-prop-1-enyl]octa-5,7-dienal (PubChem CID 144956501) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (5E)-4-[[bis(2-methylbutan-2-yl)amino]methyl]-5-[(Z)-prop-1-enyl]octa-5,7-dienal.
| Compound Name | (5E)-4-[[bis(2-methylbutan-2-yl)amino]methyl]-5-[(Z)-prop-1-enyl]octa-5,7-dienal |
|---|---|
| PubChem CID | 144956501 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (5E)-4-[[bis(2-methylbutan-2-yl)amino]methyl]-5-[(Z)-prop-1-enyl]octa-5,7-dienal |
| SMILES | C=C/C=C(\C=C/C)C(CCC=O)CN(C(C)(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C22H39NO/c1-9-14-19(15-10-2)20(16-13-17-24)18-23(21(5,6)11-3)22(7,8)12-4/h9-10,14-15,17,20H,1,11-13,16,18H2,2-8H3/b15-10-,19-14+ |
| InChIKey | FFUWBECBZPAGNM-CTRXFBHTSA-N |
| XLogP | 5.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|