C21H35NO — CID 143715219
3-[[1-cyclohepta-1,4,6-trien-1-ylethyl(methyl)amino]methyl]-5-methylheptanal;ethene (PubChem CID 143715219) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 3-[[1-cyclohepta-1,4,6-trien-1-ylethyl(methyl)amino]methyl]-5-methylheptanal;ethene.
| Compound Name | 3-[[1-cyclohepta-1,4,6-trien-1-ylethyl(methyl)amino]methyl]-5-methylheptanal;ethene |
|---|---|
| PubChem CID | 143715219 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 3-[[1-cyclohepta-1,4,6-trien-1-ylethyl(methyl)amino]methyl]-5-methylheptanal;ethene |
| SMILES | C=C.CCC(C)CC(CC=O)CN(C)C(C)C1=CCC=CC=C1 |
| InChI | InChI=1S/C19H31NO.C2H4/c1-5-16(2)14-18(12-13-21)15-20(4)17(3)19-10-8-6-7-9-11-19;1-2/h6-8,10-11,13,16-18H,5,9,12,14-15H2,1-4H3;1-2H2 |
| InChIKey | QXNHCKOIPOBCFY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|