C24H45NO — CID 57047774
4-(azepan-1-yl)-2,6-dimethylhexadec-10-enal (PubChem CID 57047774) has the molecular formula C24H45NO and a molecular weight of 363.63 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2,6-dimethylhexadec-10-enal.
| Compound Name | 4-(azepan-1-yl)-2,6-dimethylhexadec-10-enal |
|---|---|
| PubChem CID | 57047774 |
| Molecular Formula | C24H45NO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.35 |
| IUPAC Name | 4-(azepan-1-yl)-2,6-dimethylhexadec-10-enal |
| SMILES | CCCCCC=CCCCC(C)CC(CC(C)C=O)N1CCCCCC1 |
| InChI | InChI=1S/C24H45NO/c1-4-5-6-7-8-9-10-13-16-22(2)19-24(20-23(3)21-26)25-17-14-11-12-15-18-25/h8-9,21-24H,4-7,10-20H2,1-3H3 |
| InChIKey | LIGXLAYCLTYGCH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|