C26H49NO — CID 19855863
(E)-1-(2,6-dimethylazepan-1-yl)octadec-10-en-1-one (PubChem CID 19855863) has the molecular formula C26H49NO and a molecular weight of 391.68 g/mol. Its IUPAC name is (E)-1-(2,6-dimethylazepan-1-yl)octadec-10-en-1-one.
| Compound Name | (E)-1-(2,6-dimethylazepan-1-yl)octadec-10-en-1-one |
|---|---|
| PubChem CID | 19855863 |
| Molecular Formula | C26H49NO |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 391.38 |
| IUPAC Name | (E)-1-(2,6-dimethylazepan-1-yl)octadec-10-en-1-one |
| SMILES | CCCCCCC/C=C/CCCCCCCCC(=O)N1CC(C)CCCC1C |
| InChI | InChI=1S/C26H49NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-26(28)27-23-24(2)20-19-21-25(27)3/h10-11,24-25H,4-9,12-23H2,1-3H3/b11-10+ |
| InChIKey | VTLAQGJCTKXSAM-ZHACJKMWSA-N |
| XLogP | 8.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|