C21H39NO — CID 57181237
4-(azepan-1-yl)-2,6-dimethyltridec-11-enal (PubChem CID 57181237) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2,6-dimethyltridec-11-enal.
| Compound Name | 4-(azepan-1-yl)-2,6-dimethyltridec-11-enal |
|---|---|
| PubChem CID | 57181237 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | 4-(azepan-1-yl)-2,6-dimethyltridec-11-enal |
| SMILES | CC=CCCCCC(C)CC(CC(C)C=O)N1CCCCCC1 |
| InChI | InChI=1S/C21H39NO/c1-4-5-6-7-10-13-19(2)16-21(17-20(3)18-23)22-14-11-8-9-12-15-22/h4-5,18-21H,6-17H2,1-3H3 |
| InChIKey | IQZOATDGAWDCOJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|