C16H29NO — CID 142177266
(6E,8Z)-11-(dimethylamino)-2,4,8-trimethylundeca-6,8-dienal (PubChem CID 142177266) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (6E,8Z)-11-(dimethylamino)-2,4,8-trimethylundeca-6,8-dienal.
| Compound Name | (6E,8Z)-11-(dimethylamino)-2,4,8-trimethylundeca-6,8-dienal |
|---|---|
| PubChem CID | 142177266 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (6E,8Z)-11-(dimethylamino)-2,4,8-trimethylundeca-6,8-dienal |
| SMILES | CC(=C/CCN(C)C)/C=C/CC(C)CC(C)C=O |
| InChI | InChI=1S/C16H29NO/c1-14(10-7-11-17(4)5)8-6-9-15(2)12-16(3)13-18/h6,8,10,13,15-16H,7,9,11-12H2,1-5H3/b8-6+,14-10- |
| InChIKey | IRVAZCFECDZGHH-UZCZQPMLSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|