C39H71NO — CID 166078522
5-[[(8E,10E)-2-methylhexadeca-8,10-dienyl]-[(9E,11E)-2-methylhexadeca-9,11-dienyl]amino]pentanal (PubChem CID 166078522) has the molecular formula C39H71NO and a molecular weight of 570.00 g/mol. Its IUPAC name is 5-[[(8E,10E)-2-methylhexadeca-8,10-dienyl]-[(9E,11E)-2-methylhexadeca-9,11-dienyl]amino]pentanal.
| Compound Name | 5-[[(8E,10E)-2-methylhexadeca-8,10-dienyl]-[(9E,11E)-2-methylhexadeca-9,11-dienyl]amino]pentanal |
|---|---|
| PubChem CID | 166078522 |
| Molecular Formula | C39H71NO |
| Molecular Weight | 570.00 g/mol |
| Exact Mass | 569.55 |
| IUPAC Name | 5-[[(8E,10E)-2-methylhexadeca-8,10-dienyl]-[(9E,11E)-2-methylhexadeca-9,11-dienyl]amino]pentanal |
| SMILES | CCCC/C=C/C=C/CCCCCCC(C)CN(CCCCC=O)CC(C)CCCCC/C=C/C=C/CCCCC |
| InChI | InChI=1S/C39H71NO/c1-5-7-9-11-13-15-17-19-21-23-25-28-32-38(3)36-40(34-30-27-31-35-41)37-39(4)33-29-26-24-22-20-18-16-14-12-10-8-6-2/h11,13-18,20,35,38-39H,5-10,12,19,21-34,36-37H2,1-4H3/b13-11+,16-14+,17-15+,20-18+ |
| InChIKey | VUXOGGXZEWVKKS-USWDAXQBSA-N |
| XLogP | 12.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.00 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|