C13H19NO — CID 143394042
4-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylpyrrolidine-3-carbaldehyde (PubChem CID 143394042) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylpyrrolidine-3-carbaldehyde.
| Compound Name | 4-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylpyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 143394042 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-(cyclohexa-1,5-dien-1-ylmethyl)-1-methylpyrrolidine-3-carbaldehyde |
| SMILES | CN1CC(C=O)C(CC2=CCCC=C2)C1 |
| InChI | InChI=1S/C13H19NO/c1-14-8-12(13(9-14)10-15)7-11-5-3-2-4-6-11/h3,5-6,10,12-13H,2,4,7-9H2,1H3 |
| InChIKey | FJOBYUCECRUJJN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|