C17H28FNO — CID 143401945
(4R)-1-tert-butyl-4-[(2Z,6Z)-3-fluoroocta-2,6-dien-2-yl]pyrrolidine-3-carbaldehyde (PubChem CID 143401945) has the molecular formula C17H28FNO and a molecular weight of 281.41 g/mol. Its IUPAC name is (4R)-1-tert-butyl-4-[(2Z,6Z)-3-fluoroocta-2,6-dien-2-yl]pyrrolidine-3-carbaldehyde.
| Compound Name | (4R)-1-tert-butyl-4-[(2Z,6Z)-3-fluoroocta-2,6-dien-2-yl]pyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 143401945 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | (4R)-1-tert-butyl-4-[(2Z,6Z)-3-fluoroocta-2,6-dien-2-yl]pyrrolidine-3-carbaldehyde |
| SMILES | C/C=C\CC/C(F)=C(\C)[C@@H]1CN(C(C)(C)C)CC1C=O |
| InChI | InChI=1S/C17H28FNO/c1-6-7-8-9-16(18)13(2)15-11-19(17(3,4)5)10-14(15)12-20/h6-7,12,14-15H,8-11H2,1-5H3/b7-6-,16-13-/t14?,15-/m0/s1 |
| InChIKey | QGPLZZRTVYCSOH-ZNYBFCDOSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|