C14H21NO — CID 91272698
7-methyl-3-(pyrrolidin-1-ylmethyl)cyclohepta-2,4-diene-1-carbaldehyde (PubChem CID 91272698) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 7-methyl-3-(pyrrolidin-1-ylmethyl)cyclohepta-2,4-diene-1-carbaldehyde.
| Compound Name | 7-methyl-3-(pyrrolidin-1-ylmethyl)cyclohepta-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 91272698 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 7-methyl-3-(pyrrolidin-1-ylmethyl)cyclohepta-2,4-diene-1-carbaldehyde |
| SMILES | CC1CC=CC(CN2CCCC2)=CC1C=O |
| InChI | InChI=1S/C14H21NO/c1-12-5-4-6-13(9-14(12)11-16)10-15-7-2-3-8-15/h4,6,9,11-12,14H,2-3,5,7-8,10H2,1H3 |
| InChIKey | INEYQMNEHZDKSI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|