C15H25NO — CID 163936481
(2S,3S)-3-methyl-2-[methyl-[(6-methylcyclohexa-1,3-dien-1-yl)methyl]amino]pentanal (PubChem CID 163936481) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[methyl-[(6-methylcyclohexa-1,3-dien-1-yl)methyl]amino]pentanal.
| Compound Name | (2S,3S)-3-methyl-2-[methyl-[(6-methylcyclohexa-1,3-dien-1-yl)methyl]amino]pentanal |
|---|---|
| PubChem CID | 163936481 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2S,3S)-3-methyl-2-[methyl-[(6-methylcyclohexa-1,3-dien-1-yl)methyl]amino]pentanal |
| SMILES | CC[C@H](C)[C@@H](C=O)N(C)CC1=CC=CCC1C |
| InChI | InChI=1S/C15H25NO/c1-5-12(2)15(11-17)16(4)10-14-9-7-6-8-13(14)3/h6-7,9,11-13,15H,5,8,10H2,1-4H3/t12-,13?,15+/m0/s1 |
| InChIKey | RNGLNIMNZYEQRJ-RMTCENKZSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|