C13H19NO — CID 142850749
1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-2-carbaldehyde (PubChem CID 142850749) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-2-carbaldehyde.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 142850749 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1CC1=CCCC=C1 |
| InChI | InChI=1S/C13H19NO/c15-11-13-8-4-5-9-14(13)10-12-6-2-1-3-7-12/h2,6-7,11,13H,1,3-5,8-10H2 |
| InChIKey | XDMQTEXFNSLJFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|