C14H23NO — CID 143526017
1-[(2E,4Z)-2-methylhepta-2,4-dienyl]piperidine-4-carbaldehyde (PubChem CID 143526017) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-[(2E,4Z)-2-methylhepta-2,4-dienyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[(2E,4Z)-2-methylhepta-2,4-dienyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 143526017 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-[(2E,4Z)-2-methylhepta-2,4-dienyl]piperidine-4-carbaldehyde |
| SMILES | CC/C=C\C=C(/C)CN1CCC(C=O)CC1 |
| InChI | InChI=1S/C14H23NO/c1-3-4-5-6-13(2)11-15-9-7-14(12-16)8-10-15/h4-6,12,14H,3,7-11H2,1-2H3/b5-4-,13-6+ |
| InChIKey | DQPKSIWOUBZIRJ-VRPUZZSBSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|