C29H32FN5O3 — CID 138649388
10-[4-[5-[[(1E,3E)-4-fluoropenta-1,3-dienyl]amino]-1-methyl-6-oxo-3-pyridinyl]-3-(hydroxymethyl)-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one (PubChem CID 138649388) has the molecular formula C29H32FN5O3 and a molecular weight of 517.61 g/mol. Its IUPAC name is 10-[4-[5-[[(1E,3E)-4-fluoropenta-1,3-dienyl]amino]-1-methyl-6-oxo-3-pyridinyl]-3-(hydroxymethyl)-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one.
| Compound Name | 10-[4-[5-[[(1E,3E)-4-fluoropenta-1,3-dienyl]amino]-1-methyl-6-oxo-3-pyridinyl]-3-(hydroxymethyl)-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one |
|---|---|
| PubChem CID | 138649388 |
| Molecular Formula | C29H32FN5O3 |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 10-[4-[5-[[(1E,3E)-4-fluoropenta-1,3-dienyl]amino]-1-methyl-6-oxo-3-pyridinyl]-3-(hydroxymethyl)-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one |
| SMILES | C/C(F)=C\C=C\Nc1cc(-c2ccnc(N3CCn4c(cc5c4CC(C)(C)C5)C3=O)c2CO)cn(C)c1=O |
| InChI | InChI=1S/C29H32FN5O3/c1-18(30)6-5-8-31-23-12-20(16-33(4)27(23)37)21-7-9-32-26(22(21)17-36)35-11-10-34-24(28(35)38)13-19-14-29(2,3)15-25(19)34/h5-9,12-13,16,31,36H,10-11,14-15,17H2,1-4H3/b8-5+,18-6+ |
| InChIKey | VOGUXLPWGOXVGS-TYRBQJMDSA-N |
| XLogP | 4.33 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|