C23H28BrFN2O4 — CID 138650857
tert-butyl N-[5-[(2-bromo-7-fluoro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-yl]carbamate (PubChem CID 138650857) has the molecular formula C23H28BrFN2O4 and a molecular weight of 495.39 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-bromo-7-fluoro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-bromo-7-fluoro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138650857 |
| Molecular Formula | C23H28BrFN2O4 |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | tert-butyl N-[5-[(2-bromo-7-fluoro-6H-isochromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-yl]carbamate |
| SMILES | CC(COc1ccc2c(c1F)COc1cnc(Br)cc1-2)CC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H28BrFN2O4/c1-13(8-14(2)27-22(28)31-23(3,4)5)11-29-18-7-6-15-16-9-20(24)26-10-19(16)30-12-17(15)21(18)25/h6-7,9-10,13-14H,8,11-12H2,1-5H3,(H,27,28) |
| InChIKey | VNZGQCGWXNAQFH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|