About butanimidoyl 4-(dimethylamino)benzoate
butanimidoyl 4-(dimethylamino)benzoate (PubChem CID 138651080) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is butanimidoyl 4-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | butanimidoyl 4-(dimethylamino)benzoate |
| PubChem CID | 138651080 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | butanimidoyl 4-(dimethylamino)benzoate |
| SMILES | [H]/N=C(\CCC)OC(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-4-5-12(14)17-13(16)10-6-8-11(9-7-10)15(2)3/h6-9,14H,4-5H2,1-3H3/b14-12+ |
| InChIKey | RPPLRZXKGVLCQD-WYMLVPIESA-N |
| XLogP | 2.69 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butanimidoyl 4-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanimidoyl 4-(dimethylamino)benzoate?
The IUPAC name of butanimidoyl 4-(dimethylamino)benzoate (CID 138651080) is butanimidoyl 4-(dimethylamino)benzoate.
What is the SMILES notation for butanimidoyl 4-(dimethylamino)benzoate?
The canonical SMILES for butanimidoyl 4-(dimethylamino)benzoate is [H]/N=C(\CCC)OC(=O)c1ccc(N(C)C)cc1.
What is the InChIKey of butanimidoyl 4-(dimethylamino)benzoate?
The InChIKey is RPPLRZXKGVLCQD-WYMLVPIESA-N. The full InChI is InChI=1S/C13H18N2O2/c1-4-5-12(14)17-13(16)10-6-8-11(9-7-10)15(2)3/h6-9,14H,4-5H2,1-3H3/b14-12+.
What are the key properties of butanimidoyl 4-(dimethylamino)benzoate?
butanimidoyl 4-(dimethylamino)benzoate has a molecular weight of 234.30 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanimidoyl 4-(dimethylamino)benzoate is sourced from PubChem (CID 138651080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).