About butanoyl 4-acetylbenzoate
butanoyl 4-acetylbenzoate (PubChem CID 90972427) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol. Its IUPAC name is butanoyl 4-acetylbenzoate.
Molecular Properties
| Compound Name | butanoyl 4-acetylbenzoate |
| PubChem CID | 90972427 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | butanoyl 4-acetylbenzoate |
| SMILES | CCCC(=O)OC(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C13H14O4/c1-3-4-12(15)17-13(16)11-7-5-10(6-8-11)9(2)14/h5-8H,3-4H2,1-2H3 |
| InChIKey | BGLVWMBQIIRWQW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butanoyl 4-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyl 4-acetylbenzoate?
The IUPAC name of butanoyl 4-acetylbenzoate (CID 90972427) is butanoyl 4-acetylbenzoate.
What is the SMILES notation for butanoyl 4-acetylbenzoate?
The canonical SMILES for butanoyl 4-acetylbenzoate is CCCC(=O)OC(=O)c1ccc(C(C)=O)cc1.
What is the InChIKey of butanoyl 4-acetylbenzoate?
The InChIKey is BGLVWMBQIIRWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4/c1-3-4-12(15)17-13(16)11-7-5-10(6-8-11)9(2)14/h5-8H,3-4H2,1-2H3.
What are the key properties of butanoyl 4-acetylbenzoate?
butanoyl 4-acetylbenzoate has a molecular weight of 234.25 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyl 4-acetylbenzoate is sourced from PubChem (CID 90972427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).