About butanoyl 3-methylbenzoate
butanoyl 3-methylbenzoate (PubChem CID 174819018) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is butanoyl 3-methylbenzoate.
Molecular Properties
| Compound Name | butanoyl 3-methylbenzoate |
| PubChem CID | 174819018 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | butanoyl 3-methylbenzoate |
| SMILES | CCCC(=O)OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C12H14O3/c1-3-5-11(13)15-12(14)10-7-4-6-9(2)8-10/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | URFNTGZCGPMTAZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butanoyl 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyl 3-methylbenzoate?
The IUPAC name of butanoyl 3-methylbenzoate (CID 174819018) is butanoyl 3-methylbenzoate.
What is the SMILES notation for butanoyl 3-methylbenzoate?
The canonical SMILES for butanoyl 3-methylbenzoate is CCCC(=O)OC(=O)c1cccc(C)c1.
What is the InChIKey of butanoyl 3-methylbenzoate?
The InChIKey is URFNTGZCGPMTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-3-5-11(13)15-12(14)10-7-4-6-9(2)8-10/h4,6-8H,3,5H2,1-2H3.
What are the key properties of butanoyl 3-methylbenzoate?
butanoyl 3-methylbenzoate has a molecular weight of 206.24 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyl 3-methylbenzoate is sourced from PubChem (CID 174819018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).