C15H22IN3O2 — CID 138652186
2-(hydroxyamino)-N-[(2S)-1-(6-iodo-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]acetamide (PubChem CID 138652186) has the molecular formula C15H22IN3O2 and a molecular weight of 403.26 g/mol. Its IUPAC name is 2-(hydroxyamino)-N-[(2S)-1-(6-iodo-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]acetamide.
| Compound Name | 2-(hydroxyamino)-N-[(2S)-1-(6-iodo-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 138652186 |
| Molecular Formula | C15H22IN3O2 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-(hydroxyamino)-N-[(2S)-1-(6-iodo-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]acetamide |
| SMILES | C[C@@H](CN1CCCc2c(I)cccc2C1)NC(=O)CNO |
| InChI | InChI=1S/C15H22IN3O2/c1-11(18-15(20)8-17-21)9-19-7-3-5-13-12(10-19)4-2-6-14(13)16/h2,4,6,11,17,21H,3,5,7-10H2,1H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | IGXDKTLKIPQNSZ-NSHDSACASA-N |
| XLogP | 1.52 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|