C19H31N3O2 — CID 138651678
N-[(2S)-1-(8-tert-butyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]-2-(hydroxyamino)acetamide (PubChem CID 138651678) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-[(2S)-1-(8-tert-butyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]-2-(hydroxyamino)acetamide.
| Compound Name | N-[(2S)-1-(8-tert-butyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]-2-(hydroxyamino)acetamide |
|---|---|
| PubChem CID | 138651678 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | N-[(2S)-1-(8-tert-butyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)propan-2-yl]-2-(hydroxyamino)acetamide |
| SMILES | C[C@@H](CN1CCCc2ccc(C(C)(C)C)cc2C1)NC(=O)CNO |
| InChI | InChI=1S/C19H31N3O2/c1-14(21-18(23)11-20-24)12-22-9-5-6-15-7-8-17(19(2,3)4)10-16(15)13-22/h7-8,10,14,20,24H,5-6,9,11-13H2,1-4H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | QWMQJLFRAOZEDV-AWEZNQCLSA-N |
| XLogP | 2.22 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|