C17H28N4O — CID 138651702
2-(hydroxyamino)-N'-[(2S)-1-(9-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-yl)propan-2-yl]ethanimidamide (PubChem CID 138651702) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-(hydroxyamino)-N'-[(2S)-1-(9-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-yl)propan-2-yl]ethanimidamide.
| Compound Name | 2-(hydroxyamino)-N'-[(2S)-1-(9-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-yl)propan-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 138651702 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 2-(hydroxyamino)-N'-[(2S)-1-(9-methyl-3,4,5,6-tetrahydro-1H-2-benzazocin-2-yl)propan-2-yl]ethanimidamide |
| SMILES | Cc1ccc2c(c1)CN(C[C@H](C)/N=C(\N)CNO)CCCC2 |
| InChI | InChI=1S/C17H28N4O/c1-13-6-7-15-5-3-4-8-21(12-16(15)9-13)11-14(2)20-17(18)10-19-22/h6-7,9,14,19,22H,3-5,8,10-12H2,1-2H3,(H2,18,20)/t14-/m0/s1 |
| InChIKey | AUXVXPXWCMGOJH-AWEZNQCLSA-N |
| XLogP | 1.86 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|