C32H48N4O4S — CID 138657184
1-[3,3-dimethyl-2-(2,4,5,5-tetramethylhexanoylamino)butanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 138657184) has the molecular formula C32H48N4O4S and a molecular weight of 584.83 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-(2,4,5,5-tetramethylhexanoylamino)butanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[3,3-dimethyl-2-(2,4,5,5-tetramethylhexanoylamino)butanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 138657184 |
| Molecular Formula | C32H48N4O4S |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 1-[3,3-dimethyl-2-(2,4,5,5-tetramethylhexanoylamino)butanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)C(C)CC(C)C(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H48N4O4S/c1-19(14-20(2)31(4,5)6)28(38)35-27(32(7,8)9)30(40)36-17-24(37)15-25(36)29(39)33-16-22-10-12-23(13-11-22)26-21(3)34-18-41-26/h10-13,18-20,24-25,27,37H,14-17H2,1-9H3,(H,33,39)(H,35,38) |
| InChIKey | RUPJMQKHDYSPJK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |