C19H22N6O3 — CID 138664489
1-[(5S)-2-[(6-methoxy-3-pyridinyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbonyl]pyrrolidine-2-carbonitrile (PubChem CID 138664489) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-[(5S)-2-[(6-methoxy-3-pyridinyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbonyl]pyrrolidine-2-carbonitrile.
| Compound Name | 1-[(5S)-2-[(6-methoxy-3-pyridinyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbonyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 138664489 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-[(5S)-2-[(6-methoxy-3-pyridinyl)methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carbonyl]pyrrolidine-2-carbonitrile |
| SMILES | COc1ccc(Cn2nc3n(c2=O)[C@H](C(=O)N2CCCC2C#N)CCC3)cn1 |
| InChI | InChI=1S/C19H22N6O3/c1-28-17-8-7-13(11-21-17)12-24-19(27)25-15(5-2-6-16(25)22-24)18(26)23-9-3-4-14(23)10-20/h7-8,11,14-15H,2-6,9,12H2,1H3/t14?,15-/m0/s1 |
| InChIKey | QJTXVAUCCMABSS-LOACHALJSA-N |
| XLogP | 0.89 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |