C30H33FN3OP — CID 138664584
6-fluoro-4-[4-[1-[6-(1-phosphaspiro[2.3]hexan-1-yloxymethyl)-1H-benzimidazol-2-yl]ethyl]cyclohexyl]quinoline (PubChem CID 138664584) has the molecular formula C30H33FN3OP and a molecular weight of 501.59 g/mol. Its IUPAC name is 6-fluoro-4-[4-[1-[6-(1-phosphaspiro[2.3]hexan-1-yloxymethyl)-1H-benzimidazol-2-yl]ethyl]cyclohexyl]quinoline.
| Compound Name | 6-fluoro-4-[4-[1-[6-(1-phosphaspiro[2.3]hexan-1-yloxymethyl)-1H-benzimidazol-2-yl]ethyl]cyclohexyl]quinoline |
|---|---|
| PubChem CID | 138664584 |
| Molecular Formula | C30H33FN3OP |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 6-fluoro-4-[4-[1-[6-(1-phosphaspiro[2.3]hexan-1-yloxymethyl)-1H-benzimidazol-2-yl]ethyl]cyclohexyl]quinoline |
| SMILES | CC(c1nc2ccc(COP3CC34CCC4)cc2[nH]1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C30H33FN3OP/c1-19(21-4-6-22(7-5-21)24-11-14-32-26-10-8-23(31)16-25(24)26)29-33-27-9-3-20(15-28(27)34-29)17-35-36-18-30(36)12-2-13-30/h3,8-11,14-16,19,21-22H,2,4-7,12-13,17-18H2,1H3,(H,33,34) |
| InChIKey | DLSRTFCDKDFFMM-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|