C24H21ClF3N3 — CID 138664686
4-[4-[(1S)-1-(7-chloro-4,6-difluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]-6-fluoroquinoline (PubChem CID 138664686) has the molecular formula C24H21ClF3N3 and a molecular weight of 443.90 g/mol. Its IUPAC name is 4-[4-[(1S)-1-(7-chloro-4,6-difluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]-6-fluoroquinoline.
| Compound Name | 4-[4-[(1S)-1-(7-chloro-4,6-difluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]-6-fluoroquinoline |
|---|---|
| PubChem CID | 138664686 |
| Molecular Formula | C24H21ClF3N3 |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-[4-[(1S)-1-(7-chloro-4,6-difluoro-1H-benzimidazol-2-yl)ethyl]cyclohexyl]-6-fluoroquinoline |
| SMILES | C[C@H](c1nc2c(F)cc(F)c(Cl)c2[nH]1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H21ClF3N3/c1-12(24-30-22-19(28)11-18(27)21(25)23(22)31-24)13-2-4-14(5-3-13)16-8-9-29-20-7-6-15(26)10-17(16)20/h6-14H,2-5H2,1H3,(H,30,31)/t12-,13?,14?/m0/s1 |
| InChIKey | WREUFPQHOZZTED-HSBZDZAISA-N |
| XLogP | 7.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|