C24H21F4N3O — CID 138664069
6-fluoro-4-[4-[(R)-methoxy-(4,5,6-trifluoro-1H-benzimidazol-2-yl)methyl]cyclohexyl]quinoline (PubChem CID 138664069) has the molecular formula C24H21F4N3O and a molecular weight of 443.44 g/mol. Its IUPAC name is 6-fluoro-4-[4-[(R)-methoxy-(4,5,6-trifluoro-1H-benzimidazol-2-yl)methyl]cyclohexyl]quinoline.
| Compound Name | 6-fluoro-4-[4-[(R)-methoxy-(4,5,6-trifluoro-1H-benzimidazol-2-yl)methyl]cyclohexyl]quinoline |
|---|---|
| PubChem CID | 138664069 |
| Molecular Formula | C24H21F4N3O |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 6-fluoro-4-[4-[(R)-methoxy-(4,5,6-trifluoro-1H-benzimidazol-2-yl)methyl]cyclohexyl]quinoline |
| SMILES | CO[C@@H](c1nc2c(F)c(F)c(F)cc2[nH]1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H21F4N3O/c1-32-23(24-30-19-11-17(26)20(27)21(28)22(19)31-24)13-4-2-12(3-5-13)15-8-9-29-18-7-6-14(25)10-16(15)18/h6-13,23H,2-5H2,1H3,(H,30,31)/t12?,13?,23-/m1/s1 |
| InChIKey | WXQJCMVGLXVFMD-RKLPPVLTSA-N |
| XLogP | 6.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|