C10H15N2O8P — CID 138665416
[3,4-dihydroxy-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methyl dihydrogen phosphite (PubChem CID 138665416) has the molecular formula C10H15N2O8P and a molecular weight of 322.21 g/mol. Its IUPAC name is [3,4-dihydroxy-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methyl dihydrogen phosphite.
| Compound Name | [3,4-dihydroxy-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 138665416 |
| Molecular Formula | C10H15N2O8P |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [3,4-dihydroxy-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methyl dihydrogen phosphite |
| SMILES | Cn1cc(C2OC(COP(O)O)C(O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O8P/c1-12-2-4(9(15)11-10(12)16)8-7(14)6(13)5(20-8)3-19-21(17)18/h2,5-8,13-14,17-18H,3H2,1H3,(H,11,15,16) |
| InChIKey | YANVFGPBIRTGIP-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|