C13H18N2O6 — CID 123204171
5-[3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 123204171) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is 5-[3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 5-[3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123204171 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[3,4-dihydroxy-5-(methoxymethyl)oxolan-2-yl]-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1cc(C2OC(COC)C(O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H18N2O6/c1-3-4-15-5-7(12(18)14-13(15)19)11-10(17)9(16)8(21-11)6-20-2/h3,5,8-11,16-17H,1,4,6H2,2H3,(H,14,18,19) |
| InChIKey | MERYSWGOVWDMGF-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|