C15H23N3O6 — CID 174112543
5-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyrimidine-2,4-dione (PubChem CID 174112543) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is 5-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174112543 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 5-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyrimidine-2,4-dione |
| SMILES | CC(C)=CCNCn1cc([C@@H]2O[C@H](CO)C(O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H23N3O6/c1-8(2)3-4-16-7-18-5-9(14(22)17-15(18)23)13-12(21)11(20)10(6-19)24-13/h3,5,10-13,16,19-21H,4,6-7H2,1-2H3,(H,17,22,23)/t10-,11?,12?,13+/m1/s1 |
| InChIKey | WVMFDOWIOTZOJO-XVSSEFHLSA-N |
| XLogP | -1.80 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|