C16H24N2O6 — CID 168973327
5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyridine-2,4-dione (PubChem CID 168973327) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyridine-2,4-dione.
| Compound Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 168973327 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-[(3-methylbut-2-enylamino)methyl]pyridine-2,4-dione |
| SMILES | CC(C)=CCNCN1C=C([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)CC1=O |
| InChI | InChI=1S/C16H24N2O6/c1-9(2)3-4-17-8-18-6-10(11(20)5-13(18)21)16-15(23)14(22)12(7-19)24-16/h3,6,12,14-17,19,22-23H,4-5,7-8H2,1-2H3/t12-,14-,15-,16+/m1/s1 |
| InChIKey | YFARHFPOBBCNRO-MIGQKNRLSA-N |
| XLogP | -1.33 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|