C15H25N3O6 — CID 129144627
3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-5-[(3-methylbut-2-enylamino)methyl]-1,2-dihydropyrimidin-6-one (PubChem CID 129144627) has the molecular formula C15H25N3O6 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-5-[(3-methylbut-2-enylamino)methyl]-1,2-dihydropyrimidin-6-one.
| Compound Name | 3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-5-[(3-methylbut-2-enylamino)methyl]-1,2-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 129144627 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-hydroxy-5-[(3-methylbut-2-enylamino)methyl]-1,2-dihydropyrimidin-6-one |
| SMILES | CC(C)=CCNCC1=CN([C@@H]2O[C@H](CO)C(O)C2O)C(O)NC1=O |
| InChI | InChI=1S/C15H25N3O6/c1-8(2)3-4-16-5-9-6-18(15(23)17-13(9)22)14-12(21)11(20)10(7-19)24-14/h3,6,10-12,14-16,19-21,23H,4-5,7H2,1-2H3,(H,17,22)/t10-,11?,12?,14-,15?/m1/s1 |
| InChIKey | ISLCKNHKXKCACR-VMXWRGAZSA-N |
| XLogP | -2.43 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|