C12H17NO6 — CID 129263624
5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-3H-pyridine-2,6-dione (PubChem CID 129263624) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-3H-pyridine-2,6-dione.
| Compound Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 129263624 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-dimethyl-3H-pyridine-2,6-dione |
| SMILES | CC1C=C([C@@H]2O[C@H](CO)C(O)[C@@H]2O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C12H17NO6/c1-5-3-6(12(18)13(2)11(5)17)10-9(16)8(15)7(4-14)19-10/h3,5,7-10,14-16H,4H2,1-2H3/t5?,7-,8?,9+,10+/m1/s1 |
| InChIKey | LKWHZIHJKMPLIW-KVZBQHICSA-N |
| XLogP | -1.97 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|