C21H28N4O — CID 138665624
1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-en-1-one (PubChem CID 138665624) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-en-1-one.
| Compound Name | 1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 138665624 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)-3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-en-1-one |
| SMILES | C=N/C(NC1(C)CC1)=C(\C)C(C(=O)N1CCc2ncccc2C1)=C(C)C |
| InChI | InChI=1S/C21H28N4O/c1-14(2)18(15(3)19(22-5)24-21(4)9-10-21)20(26)25-12-8-17-16(13-25)7-6-11-23-17/h6-7,11,24H,5,8-10,12-13H2,1-4H3/b19-15- |
| InChIKey | MLPPISGBPMAOOL-CYVLTUHYSA-N |
| XLogP | 3.38 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|