C23H28N4O — CID 138666219
2-[3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile (PubChem CID 138666219) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile.
| Compound Name | 2-[3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 138666219 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-[3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]but-2-enoyl]-3,4-dihydro-1H-isoquinoline-6-carbonitrile |
| SMILES | C=N/C(NC1(C)CC1)=C(\C)C(C(=O)N1CCc2cc(C#N)ccc2C1)=C(C)C |
| InChI | InChI=1S/C23H28N4O/c1-15(2)20(16(3)21(25-5)26-23(4)9-10-23)22(28)27-11-8-18-12-17(13-24)6-7-19(18)14-27/h6-7,12,26H,5,8-11,14H2,1-4H3/b21-16- |
| InChIKey | NGMSKCLTVCABIO-PGMHBOJBSA-N |
| XLogP | 3.85 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|