C21H21FN4O — CID 167915463
6-cyano-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 167915463) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is 6-cyano-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 6-cyano-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 167915463 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 6-cyano-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | N#Cc1ccc2c(c1)CCN(C(=O)Nc1ccc(N3CCCC3)c(F)c1)C2 |
| InChI | InChI=1S/C21H21FN4O/c22-19-12-18(5-6-20(19)25-8-1-2-9-25)24-21(27)26-10-7-16-11-15(13-23)3-4-17(16)14-26/h3-6,11-12H,1-2,7-10,14H2,(H,24,27) |
| InChIKey | MTYGCSHDSNPWGE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|