C19H28N4O — CID 138666249
3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-pyrrol-1-ylethyl)but-2-enamide (PubChem CID 138666249) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-pyrrol-1-ylethyl)but-2-enamide.
| Compound Name | 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-pyrrol-1-ylethyl)but-2-enamide |
|---|---|
| PubChem CID | 138666249 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-methyl-2-[(E)-1-[(1-methylcyclopropyl)amino]-1-(methylideneamino)prop-1-en-2-yl]-N-(2-pyrrol-1-ylethyl)but-2-enamide |
| SMILES | C=N/C(NC1(C)CC1)=C(\C)C(C(=O)NCCn1cccc1)=C(C)C |
| InChI | InChI=1S/C19H28N4O/c1-14(2)16(15(3)17(20-5)22-19(4)8-9-19)18(24)21-10-13-23-11-6-7-12-23/h6-7,11-12,22H,5,8-10,13H2,1-4H3,(H,21,24)/b17-15- |
| InChIKey | RKPYLOGGZXXMBZ-ICFOKQHNSA-N |
| XLogP | 3.01 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|